About cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane
cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane (PubChem CID 134985738) has the molecular formula C3H2BrCl3
and a molecular weight of 224.31 g/mol. Its IUPAC name is cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane.
Molecular Properties
| Compound Name | cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane |
| PubChem CID | 134985738 |
| Molecular Formula | C3H2BrCl3 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 221.84 |
| IUPAC Name | cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane |
| SMILES | Cl[C@@H]1[C@H](Cl)C1(Cl)Br |
| InChI | InChI=1S/C3H2BrCl3/c4-3(7)1(5)2(3)6/h1-2H/t1-,2+,3? |
| InChIKey | XTDYOGWMPRVIGJ-DLHILHCESA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane?
The IUPAC name of cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane (CID 134985738) is cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane.
What is the SMILES notation for cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane?
The canonical SMILES for cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane is Cl[C@@H]1[C@H](Cl)C1(Cl)Br.
What is the InChIKey of cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane?
The InChIKey is XTDYOGWMPRVIGJ-DLHILHCESA-N. The full InChI is InChI=1S/C3H2BrCl3/c4-3(7)1(5)2(3)6/h1-2H/t1-,2+,3?.
What are the key properties of cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane?
cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane has a molecular weight of 224.31 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3R)-1-bromo-1,2,3-trichlorocyclopropane is sourced from PubChem (CID 134985738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).