About 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene
1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene (PubChem CID 134985755) has the molecular formula C10H14S
and a molecular weight of 166.29 g/mol. Its IUPAC name is 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene.
Molecular Properties
| Compound Name | 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene |
| PubChem CID | 134985755 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene |
| SMILES | C=C=C(CC1=CCCC1)SC |
| InChI | InChI=1S/C10H14S/c1-3-10(11-2)8-9-6-4-5-7-9/h6H,1,4-5,7-8H2,2H3 |
| InChIKey | MZLAWWZVGPOWCK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene?
The IUPAC name of 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene (CID 134985755) is 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene.
What is the SMILES notation for 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene?
The canonical SMILES for 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene is C=C=C(CC1=CCCC1)SC.
What is the InChIKey of 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene?
The InChIKey is MZLAWWZVGPOWCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S/c1-3-10(11-2)8-9-6-4-5-7-9/h6H,1,4-5,7-8H2,2H3.
What are the key properties of 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene?
1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene has a molecular weight of 166.29 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylsulfanylbuta-2,3-dienyl)cyclopentene is sourced from PubChem (CID 134985755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).