About 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione
2-hex-5-enylcyclohexa-2,5-diene-1,4-dione (PubChem CID 134985879) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 134985879 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=CCCCCC1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C12H14O2/c1-2-3-4-5-6-10-9-11(13)7-8-12(10)14/h2,7-9H,1,3-6H2 |
| InChIKey | UYWWZKORAONSIF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione (CID 134985879) is 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione is C=CCCCCC1=CC(=O)C=CC1=O.
What is the InChIKey of 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione?
The InChIKey is UYWWZKORAONSIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-3-4-5-6-10-9-11(13)7-8-12(10)14/h2,7-9H,1,3-6H2.
What are the key properties of 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione?
2-hex-5-enylcyclohexa-2,5-diene-1,4-dione has a molecular weight of 190.24 g/mol, XLogP of 2.37, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-5-enylcyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 134985879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).