About (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one
(E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one (PubChem CID 134985905) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one |
| PubChem CID | 134985905 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one |
| SMILES | CC/C=C(\C)C(=O)C1=CCCCO1 |
| InChI | InChI=1S/C11H16O2/c1-3-6-9(2)11(12)10-7-4-5-8-13-10/h6-7H,3-5,8H2,1-2H3/b9-6+ |
| InChIKey | HLTMMYFWXJZBPF-RMKNXTFCSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one?
The IUPAC name of (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one (CID 134985905) is (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one.
What is the SMILES notation for (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one?
The canonical SMILES for (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one is CC/C=C(\C)C(=O)C1=CCCCO1.
What is the InChIKey of (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one?
The InChIKey is HLTMMYFWXJZBPF-RMKNXTFCSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-6-9(2)11(12)10-7-4-5-8-13-10/h6-7H,3-5,8H2,1-2H3/b9-6+.
What are the key properties of (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one?
(E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one has a molecular weight of 180.25 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3,4-dihydro-2H-pyran-6-yl)-2-methylpent-2-en-1-one is sourced from PubChem (CID 134985905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).