About N-(2,3,6-trimethylphenyl)hydroxylamine
N-(2,3,6-trimethylphenyl)hydroxylamine (PubChem CID 134985993) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-(2,3,6-trimethylphenyl)hydroxylamine.
Molecular Properties
| Compound Name | N-(2,3,6-trimethylphenyl)hydroxylamine |
| PubChem CID | 134985993 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-(2,3,6-trimethylphenyl)hydroxylamine |
| SMILES | Cc1ccc(C)c(NO)c1C |
| InChI | InChI=1S/C9H13NO/c1-6-4-5-7(2)9(10-11)8(6)3/h4-5,10-11H,1-3H3 |
| InChIKey | OQMINWSZIRFKTE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3,6-trimethylphenyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3,6-trimethylphenyl)hydroxylamine?
The IUPAC name of N-(2,3,6-trimethylphenyl)hydroxylamine (CID 134985993) is N-(2,3,6-trimethylphenyl)hydroxylamine.
What is the SMILES notation for N-(2,3,6-trimethylphenyl)hydroxylamine?
The canonical SMILES for N-(2,3,6-trimethylphenyl)hydroxylamine is Cc1ccc(C)c(NO)c1C.
What is the InChIKey of N-(2,3,6-trimethylphenyl)hydroxylamine?
The InChIKey is OQMINWSZIRFKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-4-5-7(2)9(10-11)8(6)3/h4-5,10-11H,1-3H3.
What are the key properties of N-(2,3,6-trimethylphenyl)hydroxylamine?
N-(2,3,6-trimethylphenyl)hydroxylamine has a molecular weight of 151.21 g/mol, XLogP of 2.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3,6-trimethylphenyl)hydroxylamine is sourced from PubChem (CID 134985993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).