C12H19F — CID 134986127
trans-(1R,3S)-1-fluoro-1-hex-1-ynyl-2,2,3-trimethylcyclopropane (PubChem CID 134986127) has the molecular formula C12H19F and a molecular weight of 182.28 g/mol. Its IUPAC name is trans-(1R,3S)-1-fluoro-1-hex-1-ynyl-2,2,3-trimethylcyclopropane.
| Compound Name | trans-(1R,3S)-1-fluoro-1-hex-1-ynyl-2,2,3-trimethylcyclopropane |
|---|---|
| PubChem CID | 134986127 |
| Molecular Formula | C12H19F |
| Molecular Weight | 182.28 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | trans-(1R,3S)-1-fluoro-1-hex-1-ynyl-2,2,3-trimethylcyclopropane |
| SMILES | CCCCC#C[C@@]1(F)[C@@H](C)C1(C)C |
| InChI | InChI=1S/C12H19F/c1-5-6-7-8-9-12(13)10(2)11(12,3)4/h10H,5-7H2,1-4H3/t10-,12+/m0/s1 |
| InChIKey | VOYZYGCOQMXNLJ-CMPLNLGQSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|