C10H16O3 — CID 134986148
(E)-6-(1,3-dioxolan-2-yl)hept-5-en-2-one (PubChem CID 134986148) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (E)-6-(1,3-dioxolan-2-yl)hept-5-en-2-one.
| Compound Name | (E)-6-(1,3-dioxolan-2-yl)hept-5-en-2-one |
|---|---|
| PubChem CID | 134986148 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (E)-6-(1,3-dioxolan-2-yl)hept-5-en-2-one |
| SMILES | CC(=O)CC/C=C(\C)C1OCCO1 |
| InChI | InChI=1S/C10H16O3/c1-8(4-3-5-9(2)11)10-12-6-7-13-10/h4,10H,3,5-7H2,1-2H3/b8-4+ |
| InChIKey | RWPPJNOCVHHIMF-XBXARRHUSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|