About (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol
(1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol (PubChem CID 134986179) has the molecular formula C10H14OS
and a molecular weight of 182.29 g/mol. Its IUPAC name is (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol.
Molecular Properties
| Compound Name | (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol |
| PubChem CID | 134986179 |
| Molecular Formula | C10H14OS |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol |
| SMILES | CC1CS[C@H](O)C12C=CC=CC2 |
| InChI | InChI=1S/C10H14OS/c1-8-7-12-9(11)10(8)5-3-2-4-6-10/h2-5,8-9,11H,6-7H2,1H3/t8?,9-,10?/m0/s1 |
| InChIKey | YODJPSPXMFTHLG-KYHHOPLUSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol?
The IUPAC name of (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol (CID 134986179) is (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol.
What is the SMILES notation for (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol?
The canonical SMILES for (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol is CC1CS[C@H](O)C12C=CC=CC2.
What is the InChIKey of (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol?
The InChIKey is YODJPSPXMFTHLG-KYHHOPLUSA-N. The full InChI is InChI=1S/C10H14OS/c1-8-7-12-9(11)10(8)5-3-2-4-6-10/h2-5,8-9,11H,6-7H2,1H3/t8?,9-,10?/m0/s1.
What are the key properties of (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol?
(1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol has a molecular weight of 182.29 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-methyl-2-thiaspiro[4.5]deca-6,8-dien-1-ol is sourced from PubChem (CID 134986179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).