About (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine
(3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine (PubChem CID 134986338) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine.
Molecular Properties
| Compound Name | (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine |
| PubChem CID | 134986338 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine |
| SMILES | C=C(C)[C@]1(C)CCN(C)N1 |
| InChI | InChI=1S/C8H16N2/c1-7(2)8(3)5-6-10(4)9-8/h9H,1,5-6H2,2-4H3/t8-/m0/s1 |
| InChIKey | PUXHRQIHJWOPMJ-QMMMGPOBSA-N |
| XLogP | 1.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine?
The IUPAC name of (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine (CID 134986338) is (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine.
What is the SMILES notation for (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine?
The canonical SMILES for (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine is C=C(C)[C@]1(C)CCN(C)N1.
What is the InChIKey of (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine?
The InChIKey is PUXHRQIHJWOPMJ-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16N2/c1-7(2)8(3)5-6-10(4)9-8/h9H,1,5-6H2,2-4H3/t8-/m0/s1.
What are the key properties of (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine?
(3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine has a molecular weight of 140.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,3-dimethyl-3-prop-1-en-2-ylpyrazolidine is sourced from PubChem (CID 134986338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).