About (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine
(Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine (PubChem CID 134986396) has the molecular formula C7H14FN
and a molecular weight of 131.19 g/mol. Its IUPAC name is (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine |
| PubChem CID | 134986396 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine |
| SMILES | C/C=C(\F)N(CC)CC |
| InChI | InChI=1S/C7H14FN/c1-4-7(8)9(5-2)6-3/h4H,5-6H2,1-3H3/b7-4+ |
| InChIKey | GNSWRXXCPZIFCP-QPJJXVBHSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine?
The IUPAC name of (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine (CID 134986396) is (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine.
What is the SMILES notation for (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine?
The canonical SMILES for (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine is C/C=C(\F)N(CC)CC.
What is the InChIKey of (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine?
The InChIKey is GNSWRXXCPZIFCP-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H14FN/c1-4-7(8)9(5-2)6-3/h4H,5-6H2,1-3H3/b7-4+.
What are the key properties of (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine?
(Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine has a molecular weight of 131.19 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-diethyl-1-fluoroprop-1-en-1-amine is sourced from PubChem (CID 134986396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).