C9H12O4 — CID 134986455
2,3,4-trimethoxycyclohexa-2,5-dien-1-one (PubChem CID 134986455) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2,3,4-trimethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 2,3,4-trimethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 134986455 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2,3,4-trimethoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1=C(OC)C(OC)C=CC1=O |
| InChI | InChI=1S/C9H12O4/c1-11-7-5-4-6(10)8(12-2)9(7)13-3/h4-5,7H,1-3H3 |
| InChIKey | IIMGUQKBYDZTQA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |