C9H18N2O2 — CID 134986578
ethyl (NE,1Z)-N-(1-ethoxyethylidene)propanehydrazonate (PubChem CID 134986578) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is ethyl (NE,1Z)-N-(1-ethoxyethylidene)propanehydrazonate.
| Compound Name | ethyl (NE,1Z)-N-(1-ethoxyethylidene)propanehydrazonate |
|---|---|
| PubChem CID | 134986578 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | ethyl (NE,1Z)-N-(1-ethoxyethylidene)propanehydrazonate |
| SMILES | CCO/C(CC)=N\N=C(/C)OCC |
| InChI | InChI=1S/C9H18N2O2/c1-5-9(13-7-3)11-10-8(4)12-6-2/h5-7H2,1-4H3/b10-8+,11-9- |
| InChIKey | RYTZSIMCTVIQNC-GOOGBFEESA-N |
| XLogP | 2.20 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|