About 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane
3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane (PubChem CID 134986582) has the molecular formula C14H26S2
and a molecular weight of 258.50 g/mol. Its IUPAC name is 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane.
Molecular Properties
| Compound Name | 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane |
| PubChem CID | 134986582 |
| Molecular Formula | C14H26S2 |
| Molecular Weight | 258.50 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane |
| SMILES | CCSC(SCC)=C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H26S2/c1-6-15-13(16-7-2)12-8-11(3)9-14(4,5)10-12/h11H,6-10H2,1-5H3 |
| InChIKey | GSNVNHZZBMWYDZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane?
The IUPAC name of 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane (CID 134986582) is 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane.
What is the SMILES notation for 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane?
The canonical SMILES for 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane is CCSC(SCC)=C1CC(C)CC(C)(C)C1.
What is the InChIKey of 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane?
The InChIKey is GSNVNHZZBMWYDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26S2/c1-6-15-13(16-7-2)12-8-11(3)9-14(4,5)10-12/h11H,6-10H2,1-5H3.
What are the key properties of 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane?
3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane has a molecular weight of 258.50 g/mol, XLogP of 5.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(ethylsulfanyl)methylidene]-1,1,5-trimethylcyclohexane is sourced from PubChem (CID 134986582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).