About ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate
ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate (PubChem CID 134986624) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate |
| PubChem CID | 134986624 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate |
| SMILES | CCOC(=O)[C@H](CC)C1COC(C)OC1 |
| InChI | InChI=1S/C11H20O4/c1-4-10(11(12)13-5-2)9-6-14-8(3)15-7-9/h8-10H,4-7H2,1-3H3/t8?,9?,10-/m1/s1 |
| InChIKey | VWFAJWWFXKXNDL-UDNWOFFPSA-N |
| XLogP | 1.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate?
The IUPAC name of ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate (CID 134986624) is ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate.
What is the SMILES notation for ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate?
The canonical SMILES for ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate is CCOC(=O)[C@H](CC)C1COC(C)OC1.
What is the InChIKey of ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate?
The InChIKey is VWFAJWWFXKXNDL-UDNWOFFPSA-N. The full InChI is InChI=1S/C11H20O4/c1-4-10(11(12)13-5-2)9-6-14-8(3)15-7-9/h8-10H,4-7H2,1-3H3/t8?,9?,10-/m1/s1.
What are the key properties of ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate?
ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate has a molecular weight of 216.28 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-(2-methyl-1,3-dioxan-5-yl)butanoate is sourced from PubChem (CID 134986624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).