C15H30O2 — CID 134986699
2,2,6,6,9,9-hexamethyl-1,3-dioxacycloundecane (PubChem CID 134986699) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 2,2,6,6,9,9-hexamethyl-1,3-dioxacycloundecane.
| Compound Name | 2,2,6,6,9,9-hexamethyl-1,3-dioxacycloundecane |
|---|---|
| PubChem CID | 134986699 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2,2,6,6,9,9-hexamethyl-1,3-dioxacycloundecane |
| SMILES | CC1(C)CCOC(C)(C)OCCC(C)(C)CC1 |
| InChI | InChI=1S/C15H30O2/c1-13(2)7-8-14(3,4)10-12-17-15(5,6)16-11-9-13/h7-12H2,1-6H3 |
| InChIKey | ARQIHPNOTXUTLH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |