About (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene
(3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene (PubChem CID 134986711) has the molecular formula C8H14S2
and a molecular weight of 174.33 g/mol. Its IUPAC name is (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene.
Molecular Properties
| Compound Name | (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene |
| PubChem CID | 134986711 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene |
| SMILES | C/C=C/C(C)=C(SC)SC |
| InChI | InChI=1S/C8H14S2/c1-5-6-7(2)8(9-3)10-4/h5-6H,1-4H3/b6-5+ |
| InChIKey | NXWBRKZCCNQDPO-AATRIKPKSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene?
The IUPAC name of (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene (CID 134986711) is (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene.
What is the SMILES notation for (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene?
The canonical SMILES for (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene is C/C=C/C(C)=C(SC)SC.
What is the InChIKey of (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene?
The InChIKey is NXWBRKZCCNQDPO-AATRIKPKSA-N. The full InChI is InChI=1S/C8H14S2/c1-5-6-7(2)8(9-3)10-4/h5-6H,1-4H3/b6-5+.
What are the key properties of (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene?
(3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene has a molecular weight of 174.33 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-methyl-1,1-bis(methylsulfanyl)penta-1,3-diene is sourced from PubChem (CID 134986711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).