About 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene
4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene (PubChem CID 134986735) has the molecular formula C12H24S2
and a molecular weight of 232.46 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene |
| PubChem CID | 134986735 |
| Molecular Formula | C12H24S2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene |
| SMILES | C=C(C)C(C)(C)C(CC)(SC)SCC |
| InChI | InChI=1S/C12H24S2/c1-8-12(13-7,14-9-2)11(5,6)10(3)4/h3,8-9H2,1-2,4-7H3 |
| InChIKey | CAIOCOCXODZUET-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene?
The IUPAC name of 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene (CID 134986735) is 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene.
What is the SMILES notation for 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene?
The canonical SMILES for 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene is C=C(C)C(C)(C)C(CC)(SC)SCC.
What is the InChIKey of 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene?
The InChIKey is CAIOCOCXODZUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24S2/c1-8-12(13-7,14-9-2)11(5,6)10(3)4/h3,8-9H2,1-2,4-7H3.
What are the key properties of 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene?
4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene has a molecular weight of 232.46 g/mol, XLogP of 4.81, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-2,3,3-trimethyl-4-methylsulfanylhex-1-ene is sourced from PubChem (CID 134986735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).