About 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane
1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane (PubChem CID 134986766) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane.
Molecular Properties
| Compound Name | 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane |
| PubChem CID | 134986766 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane |
| SMILES | CCCCCCC1(C)C(CC)C12OCCO2 |
| InChI | InChI=1S/C14H26O2/c1-4-6-7-8-9-13(3)12(5-2)14(13)15-10-11-16-14/h12H,4-11H2,1-3H3 |
| InChIKey | CBFQLLABRFVQED-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane?
The IUPAC name of 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane (CID 134986766) is 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane.
What is the SMILES notation for 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane?
The canonical SMILES for 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane is CCCCCCC1(C)C(CC)C12OCCO2.
What is the InChIKey of 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane?
The InChIKey is CBFQLLABRFVQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-4-6-7-8-9-13(3)12(5-2)14(13)15-10-11-16-14/h12H,4-11H2,1-3H3.
What are the key properties of 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane?
1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane has a molecular weight of 226.36 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-hexyl-2-methyl-4,7-dioxaspiro[2.4]heptane is sourced from PubChem (CID 134986766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).