C10H12O5 — CID 134986788
(1S,2R,6R,7R)-3-acetyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde (PubChem CID 134986788) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (1S,2R,6R,7R)-3-acetyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde.
| Compound Name | (1S,2R,6R,7R)-3-acetyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
|---|---|
| PubChem CID | 134986788 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (1S,2R,6R,7R)-3-acetyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
| SMILES | CC(=O)C1C(C=O)C[C@H]2[C@H]3OO[C@H](O3)[C@@H]12 |
| InChI | InChI=1S/C10H12O5/c1-4(12)7-5(3-11)2-6-8(7)10-13-9(6)14-15-10/h3,5-10H,2H2,1H3/t5?,6-,7?,8-,9-,10+/m1/s1 |
| InChIKey | GWWPRKACQDRKPL-QCNRSYDXSA-N |
| XLogP | 0.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|