C5Li2S7 — CID 134986881
dilithium;2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dithiolate (PubChem CID 134986881) has the molecular formula C5Li2S7 and a molecular weight of 298.41 g/mol. Its IUPAC name is dilithium;2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dithiolate.
| Compound Name | dilithium;2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dithiolate |
|---|---|
| PubChem CID | 134986881 |
| Molecular Formula | C5Li2S7 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 297.84 |
| IUPAC Name | dilithium;2-sulfanylidene-[1,3]dithiolo[4,5-b][1,4]dithiine-5,6-dithiolate |
| SMILES | S=c1sc2c(s1)SC([S-])=C([S-])S2.[Li+].[Li+] |
| InChI | InChI=1S/C5H2S7.2Li/c6-1-2(7)10-4-3(9-1)11-5(8)12-4;;/h6-7H;;/q;2*+1/p-2 |
| InChIKey | DGWWDFOLAOQPLG-UHFFFAOYSA-L |
| XLogP | -2.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|