C11H7Cl3N2 — CID 134987035
4-benzyl-2,5,6-trichloropyrimidine (PubChem CID 134987035) has the molecular formula C11H7Cl3N2 and a molecular weight of 273.55 g/mol. Its IUPAC name is 4-benzyl-2,5,6-trichloropyrimidine.
| Compound Name | 4-benzyl-2,5,6-trichloropyrimidine |
|---|---|
| PubChem CID | 134987035 |
| Molecular Formula | C11H7Cl3N2 |
| Molecular Weight | 273.55 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 4-benzyl-2,5,6-trichloropyrimidine |
| SMILES | Clc1nc(Cl)c(Cl)c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C11H7Cl3N2/c12-9-8(15-11(14)16-10(9)13)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | TXWWHJYSZCUBHK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |