C10H11NO — CID 134987076
7-methyl-5,8-dihydro-2H-isoquinolin-1-one (PubChem CID 134987076) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 7-methyl-5,8-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-methyl-5,8-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 134987076 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 7-methyl-5,8-dihydro-2H-isoquinolin-1-one |
| SMILES | CC1=CCc2cc[nH]c(=O)c2C1 |
| InChI | InChI=1S/C10H11NO/c1-7-2-3-8-4-5-11-10(12)9(8)6-7/h2,4-5H,3,6H2,1H3,(H,11,12) |
| InChIKey | BCLYNOIMLNIGDG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|