About 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene
3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene (PubChem CID 134987134) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene.
Analyze 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene?
The IUPAC name of 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene (CID 134987134) is 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene.
What is the SMILES notation for 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene?
The canonical SMILES for 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene is c1cc2ncc3c(c2s1)CCC3.
What is the InChIKey of 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene?
The InChIKey is QOAHESDJXXGLQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c1-2-7-6-11-9-4-5-12-10(9)8(7)3-1/h4-6H,1-3H2.
What are the key properties of 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene?
3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene has a molecular weight of 175.26 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thia-7-azatricyclo[7.3.0.02,6]dodeca-1,4,6,8-tetraene is sourced from PubChem (CID 134987134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).