C10H14N8 — CID 134987147
2-piperazin-1-ylpyrimido[4,5-d]pyrimidine-5,7-diamine (PubChem CID 134987147) has the molecular formula C10H14N8 and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-piperazin-1-ylpyrimido[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 2-piperazin-1-ylpyrimido[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 134987147 |
| Molecular Formula | C10H14N8 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-piperazin-1-ylpyrimido[4,5-d]pyrimidine-5,7-diamine |
| SMILES | Nc1nc(N)c2cnc(N3CCNCC3)nc2n1 |
| InChI | InChI=1S/C10H14N8/c11-7-6-5-14-10(18-3-1-13-2-4-18)17-8(6)16-9(12)15-7/h5,13H,1-4H2,(H4,11,12,14,15,16,17) |
| InChIKey | KTEGMGXQXWIXHW-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |