C12H11NO3S2 — CID 134987211
1-methyl-6,7-bis(methylsulfanyl)-2H-isoquinoline-3,5,8-trione (PubChem CID 134987211) has the molecular formula C12H11NO3S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-methyl-6,7-bis(methylsulfanyl)-2H-isoquinoline-3,5,8-trione.
| Compound Name | 1-methyl-6,7-bis(methylsulfanyl)-2H-isoquinoline-3,5,8-trione |
|---|---|
| PubChem CID | 134987211 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 1-methyl-6,7-bis(methylsulfanyl)-2H-isoquinoline-3,5,8-trione |
| SMILES | CSC1=C(SC)C(=O)c2c(cc(=O)[nH]c2C)C1=O |
| InChI | InChI=1S/C12H11NO3S2/c1-5-8-6(4-7(14)13-5)9(15)11(17-2)12(18-3)10(8)16/h4H,1-3H3,(H,13,14) |
| InChIKey | NDHSEKNHZOYTIH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|