About (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene
(1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene (PubChem CID 134987282) has the molecular formula C11H20SSe
and a molecular weight of 263.31 g/mol. Its IUPAC name is (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene.
Molecular Properties
| Compound Name | (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene |
| PubChem CID | 134987282 |
| Molecular Formula | C11H20SSe |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene |
| SMILES | C=CC/C=C(\SCCCC)[Se]CC |
| InChI | InChI=1S/C11H20SSe/c1-4-7-9-11(13-6-3)12-10-8-5-2/h4,9H,1,5-8,10H2,2-3H3/b11-9+ |
| InChIKey | HJZDOSGRTJEHOU-PKNBQFBNSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene?
The IUPAC name of (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene (CID 134987282) is (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene.
What is the SMILES notation for (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene?
The canonical SMILES for (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene is C=CC/C=C(\SCCCC)[Se]CC.
What is the InChIKey of (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene?
The InChIKey is HJZDOSGRTJEHOU-PKNBQFBNSA-N. The full InChI is InChI=1S/C11H20SSe/c1-4-7-9-11(13-6-3)12-10-8-5-2/h4,9H,1,5-8,10H2,2-3H3/b11-9+.
What are the key properties of (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene?
(1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene has a molecular weight of 263.31 g/mol, XLogP of 4.08, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-butylsulfanyl-1-ethylselanylpenta-1,4-diene is sourced from PubChem (CID 134987282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).