C14H24O4 — CID 134987462
methyl 6-(2,2-dimethoxyethyl)-2,6-dimethylcyclohexene-1-carboxylate (PubChem CID 134987462) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is methyl 6-(2,2-dimethoxyethyl)-2,6-dimethylcyclohexene-1-carboxylate.
| Compound Name | methyl 6-(2,2-dimethoxyethyl)-2,6-dimethylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134987462 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | methyl 6-(2,2-dimethoxyethyl)-2,6-dimethylcyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CCCC1(C)CC(OC)OC |
| InChI | InChI=1S/C14H24O4/c1-10-7-6-8-14(2,9-11(16-3)17-4)12(10)13(15)18-5/h11H,6-9H2,1-5H3 |
| InChIKey | JDKHARSKLXFKJD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|