About (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal
(E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal (PubChem CID 134987735) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal.
Molecular Properties
| Compound Name | (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal |
| PubChem CID | 134987735 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal |
| SMILES | CC[C@H]1O[C@@H](/C(C)=C/CCC=O)CC=C1C |
| InChI | InChI=1S/C14H22O2/c1-4-13-12(3)8-9-14(16-13)11(2)7-5-6-10-15/h7-8,10,13-14H,4-6,9H2,1-3H3/b11-7+/t13-,14-/m1/s1 |
| InChIKey | WUGOQKHVWFJZAP-VAZNYKRKSA-N |
| XLogP | 3.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal?
The IUPAC name of (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal (CID 134987735) is (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal.
What is the SMILES notation for (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal?
The canonical SMILES for (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal is CC[C@H]1O[C@@H](/C(C)=C/CCC=O)CC=C1C.
What is the InChIKey of (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal?
The InChIKey is WUGOQKHVWFJZAP-VAZNYKRKSA-N. The full InChI is InChI=1S/C14H22O2/c1-4-13-12(3)8-9-14(16-13)11(2)7-5-6-10-15/h7-8,10,13-14H,4-6,9H2,1-3H3/b11-7+/t13-,14-/m1/s1.
What are the key properties of (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal?
(E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal has a molecular weight of 222.33 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]hex-4-enal is sourced from PubChem (CID 134987735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).