C12H24O2Si — CID 134987743
trimethyl-[(E,3R)-3-(oxan-2-yloxy)but-1-enyl]silane (PubChem CID 134987743) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is trimethyl-[(E,3R)-3-(oxan-2-yloxy)but-1-enyl]silane.
| Compound Name | trimethyl-[(E,3R)-3-(oxan-2-yloxy)but-1-enyl]silane |
|---|---|
| PubChem CID | 134987743 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | trimethyl-[(E,3R)-3-(oxan-2-yloxy)but-1-enyl]silane |
| SMILES | C[C@H](/C=C/[Si](C)(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C12H24O2Si/c1-11(8-10-15(2,3)4)14-12-7-5-6-9-13-12/h8,10-12H,5-7,9H2,1-4H3/b10-8+/t11-,12?/m1/s1 |
| InChIKey | USSSCMGKLNJQRG-XXQJFNKASA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|