About 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane
2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane (PubChem CID 134987856) has the molecular formula C10H16S2
and a molecular weight of 200.37 g/mol. Its IUPAC name is 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane |
| PubChem CID | 134987856 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane |
| SMILES | CC(C)=CC(C)=C1SCCCS1 |
| InChI | InChI=1S/C10H16S2/c1-8(2)7-9(3)10-11-5-4-6-12-10/h7H,4-6H2,1-3H3 |
| InChIKey | NRRBBHATPUPANP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane?
The IUPAC name of 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane (CID 134987856) is 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane.
What is the SMILES notation for 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane?
The canonical SMILES for 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane is CC(C)=CC(C)=C1SCCCS1.
What is the InChIKey of 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane?
The InChIKey is NRRBBHATPUPANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S2/c1-8(2)7-9(3)10-11-5-4-6-12-10/h7H,4-6H2,1-3H3.
What are the key properties of 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane?
2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane has a molecular weight of 200.37 g/mol, XLogP of 4.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpent-3-en-2-ylidene)-1,3-dithiane is sourced from PubChem (CID 134987856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).