About 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one
2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one (PubChem CID 134987880) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one.
Molecular Properties
| Compound Name | 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one |
| PubChem CID | 134987880 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one |
| SMILES | C=C(C)C1C=CC(C)(CCC(OC)OC)C(=O)C1 |
| InChI | InChI=1S/C15H24O3/c1-11(2)12-6-8-15(3,13(16)10-12)9-7-14(17-4)18-5/h6,8,12,14H,1,7,9-10H2,2-5H3 |
| InChIKey | DSNWHBHRULPVJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one?
The IUPAC name of 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one (CID 134987880) is 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one.
What is the SMILES notation for 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one?
The canonical SMILES for 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one is C=C(C)C1C=CC(C)(CCC(OC)OC)C(=O)C1.
What is the InChIKey of 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one?
The InChIKey is DSNWHBHRULPVJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-11(2)12-6-8-15(3,13(16)10-12)9-7-14(17-4)18-5/h6,8,12,14H,1,7,9-10H2,2-5H3.
What are the key properties of 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one?
2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one has a molecular weight of 252.35 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-3-en-1-one is sourced from PubChem (CID 134987880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).