About (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol
(E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol (PubChem CID 134987922) has the molecular formula C11H21IO3
and a molecular weight of 328.19 g/mol. Its IUPAC name is (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol.
Molecular Properties
| Compound Name | (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol |
| PubChem CID | 134987922 |
| Molecular Formula | C11H21IO3 |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol |
| SMILES | COC(C/C(C)=C(/I)C(O)C(C)C)OC |
| InChI | InChI=1S/C11H21IO3/c1-7(2)11(13)10(12)8(3)6-9(14-4)15-5/h7,9,11,13H,6H2,1-5H3/b10-8+ |
| InChIKey | VXOLMTFKHZLZRS-CSKARUKUSA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol?
The IUPAC name of (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol (CID 134987922) is (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol.
What is the SMILES notation for (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol?
The canonical SMILES for (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol is COC(C/C(C)=C(/I)C(O)C(C)C)OC.
What is the InChIKey of (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol?
The InChIKey is VXOLMTFKHZLZRS-CSKARUKUSA-N. The full InChI is InChI=1S/C11H21IO3/c1-7(2)11(13)10(12)8(3)6-9(14-4)15-5/h7,9,11,13H,6H2,1-5H3/b10-8+.
What are the key properties of (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol?
(E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol has a molecular weight of 328.19 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-iodo-7,7-dimethoxy-2,5-dimethylhept-4-en-3-ol is sourced from PubChem (CID 134987922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).