C10H18ClO3P — CID 134987925
1-chloro-1-diethoxyphosphoryl-3-methylpenta-1,2-diene (PubChem CID 134987925) has the molecular formula C10H18ClO3P and a molecular weight of 252.68 g/mol. Its IUPAC name is 1-chloro-1-diethoxyphosphoryl-3-methylpenta-1,2-diene.
| Compound Name | 1-chloro-1-diethoxyphosphoryl-3-methylpenta-1,2-diene |
|---|---|
| PubChem CID | 134987925 |
| Molecular Formula | C10H18ClO3P |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-chloro-1-diethoxyphosphoryl-3-methylpenta-1,2-diene |
| SMILES | CCOP(=O)(OCC)C(Cl)=C=C(C)CC |
| InChI | InChI=1S/C10H18ClO3P/c1-5-9(4)8-10(11)15(12,13-6-2)14-7-3/h5-7H2,1-4H3 |
| InChIKey | LUAUQBBJOVWAGO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|