C14H28O3Si — CID 134988135
cis-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carboxylic acid (PubChem CID 134988135) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is cis-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134988135 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | cis-(1R,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H28O3Si/c1-14(2,3)18(4,5)17-10-11-8-6-7-9-12(11)13(15)16/h11-12H,6-10H2,1-5H3,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | GKIXLVBIDOCMFS-NWDGAFQWSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|