C15H24O3 — CID 134988302
ethyl 2-(1-hydroxyprop-2-enyl)-5,6,6-trimethylhepta-3,4-dienoate (PubChem CID 134988302) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethyl 2-(1-hydroxyprop-2-enyl)-5,6,6-trimethylhepta-3,4-dienoate.
| Compound Name | ethyl 2-(1-hydroxyprop-2-enyl)-5,6,6-trimethylhepta-3,4-dienoate |
|---|---|
| PubChem CID | 134988302 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl 2-(1-hydroxyprop-2-enyl)-5,6,6-trimethylhepta-3,4-dienoate |
| SMILES | C=CC(O)C(C=C=C(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H24O3/c1-7-13(16)12(14(17)18-8-2)10-9-11(3)15(4,5)6/h7,10,12-13,16H,1,8H2,2-6H3 |
| InChIKey | IIXKZMXLQDFRAV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|