C7F12 — CID 134988312
1,1,4,5,5,5-hexafluoro-3,4-bis(trifluoromethyl)penta-1,2-diene (PubChem CID 134988312) has the molecular formula C7F12 and a molecular weight of 312.05 g/mol. Its IUPAC name is 1,1,4,5,5,5-hexafluoro-3,4-bis(trifluoromethyl)penta-1,2-diene.
| Compound Name | 1,1,4,5,5,5-hexafluoro-3,4-bis(trifluoromethyl)penta-1,2-diene |
|---|---|
| PubChem CID | 134988312 |
| Molecular Formula | C7F12 |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 1,1,4,5,5,5-hexafluoro-3,4-bis(trifluoromethyl)penta-1,2-diene |
| SMILES | FC(F)=C=C(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7F12/c8-3(9)1-2(5(11,12)13)4(10,6(14,15)16)7(17,18)19 |
| InChIKey | ZJDHFCQDCHLISJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |