About CID 134988542
CID 134988542 (PubChem CID 134988542) has the molecular formula C11H14NOSe
and a molecular weight of 255.20 g/mol.
Molecular Properties
| Compound Name | CID 134988542 |
| PubChem CID | 134988542 |
| Molecular Formula | C11H14NOSe |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | — |
| SMILES | CCOC(C)/N=C(\[Se])c1ccccc1 |
| InChI | InChI=1S/C11H14NOSe/c1-3-13-9(2)12-11(14)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3/b12-11- |
| InChIKey | HKAPAOZCMJHOEK-QXMHVHEDSA-N |
| XLogP | 1.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 134988542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134988542?
The IUPAC name of CID 134988542 (CID 134988542) is not available.
What is the SMILES notation for CID 134988542?
The canonical SMILES for CID 134988542 is CCOC(C)/N=C(\[Se])c1ccccc1.
What is the InChIKey of CID 134988542?
The InChIKey is HKAPAOZCMJHOEK-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H14NOSe/c1-3-13-9(2)12-11(14)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3/b12-11-.
What are the key properties of CID 134988542?
CID 134988542 has a molecular weight of 255.20 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134988542 is sourced from PubChem (CID 134988542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).