C12H17NO — CID 134988556
(2E,4E)-1-pyrrolidin-1-ylocta-2,4,7-trien-1-one (PubChem CID 134988556) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2E,4E)-1-pyrrolidin-1-ylocta-2,4,7-trien-1-one.
| Compound Name | (2E,4E)-1-pyrrolidin-1-ylocta-2,4,7-trien-1-one |
|---|---|
| PubChem CID | 134988556 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2E,4E)-1-pyrrolidin-1-ylocta-2,4,7-trien-1-one |
| SMILES | C=CC/C=C/C=C/C(=O)N1CCCC1 |
| InChI | InChI=1S/C12H17NO/c1-2-3-4-5-6-9-12(14)13-10-7-8-11-13/h2,4-6,9H,1,3,7-8,10-11H2/b5-4+,9-6+ |
| InChIKey | RSAXXHUTQBCXCF-HSKKLARCSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|