About [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate (PubChem CID 134988647) has the molecular formula C13H19IO4
and a molecular weight of 366.20 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate.
Molecular Properties
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate |
| PubChem CID | 134988647 |
| Molecular Formula | C13H19IO4 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate |
| SMILES | CC1(C)COC(=O)[C@@H]1OC(=O)[C@H](I)C1CCCC1 |
| InChI | InChI=1S/C13H19IO4/c1-13(2)7-17-12(16)10(13)18-11(15)9(14)8-5-3-4-6-8/h8-10H,3-7H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | OXNHTQJXODCVAN-ZJUUUORDSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate?
The IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate (CID 134988647) is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate.
What is the SMILES notation for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate?
The canonical SMILES for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate is CC1(C)COC(=O)[C@@H]1OC(=O)[C@H](I)C1CCCC1.
What is the InChIKey of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate?
The InChIKey is OXNHTQJXODCVAN-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H19IO4/c1-13(2)7-17-12(16)10(13)18-11(15)9(14)8-5-3-4-6-8/h8-10H,3-7H2,1-2H3/t9-,10+/m1/s1.
What are the key properties of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate?
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate has a molecular weight of 366.20 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-2-cyclopentyl-2-iodoacetate is sourced from PubChem (CID 134988647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).