C10H16O3S — CID 134988670
methyl (1S,6R)-3,4,6-trimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 134988670) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is methyl (1S,6R)-3,4,6-trimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | methyl (1S,6R)-3,4,6-trimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 134988670 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | methyl (1S,6R)-3,4,6-trimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC(C)=C(C)C[S@@]1=O |
| InChI | InChI=1S/C10H16O3S/c1-7-5-10(3,9(11)13-4)14(12)6-8(7)2/h5-6H2,1-4H3/t10-,14+/m1/s1 |
| InChIKey | APJMQSFRZFBEBZ-YGRLFVJLSA-N |
| XLogP | 1.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|