About 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane]
2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] (PubChem CID 134988671) has the molecular formula C11H16S
and a molecular weight of 180.32 g/mol. Its IUPAC name is 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane].
Molecular Properties
| Compound Name | 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] |
| PubChem CID | 134988671 |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] |
| SMILES | CC1SC2(CC2)C(C)C2=C1CC2 |
| InChI | InChI=1S/C11H16S/c1-7-9-3-4-10(9)8(2)12-11(7)5-6-11/h7-8H,3-6H2,1-2H3 |
| InChIKey | FIDJKFZLYHDTEG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane]?
The IUPAC name of 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] (CID 134988671) is 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane].
What is the SMILES notation for 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane]?
The canonical SMILES for 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] is CC1SC2(CC2)C(C)C2=C1CC2.
What is the InChIKey of 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane]?
The InChIKey is FIDJKFZLYHDTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16S/c1-7-9-3-4-10(9)8(2)12-11(7)5-6-11/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane]?
2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] has a molecular weight of 180.32 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylspiro[3-thiabicyclo[4.2.0]oct-1(6)-ene-4,1'-cyclopropane] is sourced from PubChem (CID 134988671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).