About 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane
2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane (PubChem CID 134988719) has the molecular formula C14H24OS2
and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane |
| PubChem CID | 134988719 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane |
| SMILES | C=C1CC[C@@H](OC)C(C)(C)C1C1SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-10-6-7-11(15-4)14(2,3)12(10)13-16-8-5-9-17-13/h11-13H,1,5-9H2,2-4H3/t11-,12?/m1/s1 |
| InChIKey | KEJVANHERNMDNW-JHJMLUEUSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane?
The IUPAC name of 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane (CID 134988719) is 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane.
What is the SMILES notation for 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane?
The canonical SMILES for 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane is C=C1CC[C@@H](OC)C(C)(C)C1C1SCCCS1.
What is the InChIKey of 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane?
The InChIKey is KEJVANHERNMDNW-JHJMLUEUSA-N. The full InChI is InChI=1S/C14H24OS2/c1-10-6-7-11(15-4)14(2,3)12(10)13-16-8-5-9-17-13/h11-13H,1,5-9H2,2-4H3/t11-,12?/m1/s1.
What are the key properties of 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane?
2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane has a molecular weight of 272.48 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-3-methoxy-2,2-dimethyl-6-methylidenecyclohexyl]-1,3-dithiane is sourced from PubChem (CID 134988719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).