About (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene
(Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene (PubChem CID 134988917) has the molecular formula C6H7Cl3S
and a molecular weight of 217.55 g/mol. Its IUPAC name is (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene.
Molecular Properties
| Compound Name | (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene |
| PubChem CID | 134988917 |
| Molecular Formula | C6H7Cl3S |
| Molecular Weight | 217.55 g/mol |
| Exact Mass | 215.93 |
| IUPAC Name | (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene |
| SMILES | C/C=C\CSC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C6H7Cl3S/c1-2-3-4-10-6(9)5(7)8/h2-3H,4H2,1H3/b3-2- |
| InChIKey | GRIQUUGAQCCVEA-IHWYPQMZSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
The IUPAC name of (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene (CID 134988917) is (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene.
What is the SMILES notation for (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
The canonical SMILES for (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene is C/C=C\CSC(Cl)=C(Cl)Cl.
What is the InChIKey of (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
The InChIKey is GRIQUUGAQCCVEA-IHWYPQMZSA-N. The full InChI is InChI=1S/C6H7Cl3S/c1-2-3-4-10-6(9)5(7)8/h2-3H,4H2,1H3/b3-2-.
What are the key properties of (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
(Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene has a molecular weight of 217.55 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene is sourced from PubChem (CID 134988917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).