About 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene
2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene (PubChem CID 134988967) has the molecular formula C8H11Cl3S
and a molecular weight of 245.60 g/mol. Its IUPAC name is 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene.
Molecular Properties
| Compound Name | 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene |
| PubChem CID | 134988967 |
| Molecular Formula | C8H11Cl3S |
| Molecular Weight | 245.60 g/mol |
| Exact Mass | 243.96 |
| IUPAC Name | 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene |
| SMILES | CC(C)=C(C)CSC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C8H11Cl3S/c1-5(2)6(3)4-12-8(11)7(9)10/h4H2,1-3H3 |
| InChIKey | GDEJVWIKBBUULS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
The IUPAC name of 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene (CID 134988967) is 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene.
What is the SMILES notation for 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
The canonical SMILES for 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene is CC(C)=C(C)CSC(Cl)=C(Cl)Cl.
What is the InChIKey of 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
The InChIKey is GDEJVWIKBBUULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11Cl3S/c1-5(2)6(3)4-12-8(11)7(9)10/h4H2,1-3H3.
What are the key properties of 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene?
2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene has a molecular weight of 245.60 g/mol, XLogP of 4.92, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1-(1,2,2-trichloroethenylsulfanyl)but-2-ene is sourced from PubChem (CID 134988967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).