C5H2F4N2O — CID 13498926
N-(2,3,5,6-tetrafluoro-4-pyridinyl)hydroxylamine (PubChem CID 13498926) has the molecular formula C5H2F4N2O and a molecular weight of 182.08 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluoro-4-pyridinyl)hydroxylamine.
| Compound Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)hydroxylamine |
|---|---|
| PubChem CID | 13498926 |
| Molecular Formula | C5H2F4N2O |
| Molecular Weight | 182.08 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)hydroxylamine |
| SMILES | ONc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C5H2F4N2O/c6-1-3(11-12)2(7)5(9)10-4(1)8/h12H,(H,10,11) |
| InChIKey | NDCBSPSGXKVZLO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.08 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|