About ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate
ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate (PubChem CID 134989435) has the molecular formula C14H18ClNO2S
and a molecular weight of 299.82 g/mol. Its IUPAC name is ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate |
| PubChem CID | 134989435 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate |
| SMILES | CCOC(=O)C/N=C(\Cl)Sc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H18ClNO2S/c1-5-18-12(17)8-16-14(15)19-13-10(3)6-9(2)7-11(13)4/h6-7H,5,8H2,1-4H3/b16-14+ |
| InChIKey | OJYYMECKUJLJFC-JQIJEIRASA-N |
| XLogP | 3.86 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate?
The IUPAC name of ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate (CID 134989435) is ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate.
What is the SMILES notation for ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate?
The canonical SMILES for ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate is CCOC(=O)C/N=C(\Cl)Sc1c(C)cc(C)cc1C.
What is the InChIKey of ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate?
The InChIKey is OJYYMECKUJLJFC-JQIJEIRASA-N. The full InChI is InChI=1S/C14H18ClNO2S/c1-5-18-12(17)8-16-14(15)19-13-10(3)6-9(2)7-11(13)4/h6-7H,5,8H2,1-4H3/b16-14+.
What are the key properties of ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate?
ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate has a molecular weight of 299.82 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[chloro-(2,4,6-trimethylphenyl)sulfanylmethylidene]amino]acetate is sourced from PubChem (CID 134989435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).