C16H14N2 — CID 134989464
(1Z,9Z)-9,10-dimethyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 134989464) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (1Z,9Z)-9,10-dimethyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,9Z)-9,10-dimethyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 134989464 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (1Z,9Z)-9,10-dimethyl-8,11-diazatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | CC1=C(C)/N=c2/cccc/c2=c2\cccc\c2=N\1 |
| InChI | InChI=1S/C16H14N2/c1-11-12(2)18-16-10-6-4-8-14(16)13-7-3-5-9-15(13)17-11/h3-10H,1-2H3/b12-11-,14-13-,17-11-,17-15-,18-12-,18-16- |
| InChIKey | RPAZIPYAVCGKAZ-YOTKPBTJSA-N |
| XLogP | 2.48 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |