C15H25N3O — CID 134989648
2-(diethylamino)-N,N-diethyl-3H-azepine-6-carboxamide (PubChem CID 134989648) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(diethylamino)-N,N-diethyl-3H-azepine-6-carboxamide.
| Compound Name | 2-(diethylamino)-N,N-diethyl-3H-azepine-6-carboxamide |
|---|---|
| PubChem CID | 134989648 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-(diethylamino)-N,N-diethyl-3H-azepine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=CN=C(N(CC)CC)CC=C1 |
| InChI | InChI=1S/C15H25N3O/c1-5-17(6-2)14-11-9-10-13(12-16-14)15(19)18(7-3)8-4/h9-10,12H,5-8,11H2,1-4H3 |
| InChIKey | AQNYBMLBKXKEHR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |