About 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine
1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine (PubChem CID 134989864) has the molecular formula C5H9IN2S3
and a molecular weight of 320.25 g/mol. Its IUPAC name is 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine.
Molecular Properties
| Compound Name | 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine |
| PubChem CID | 134989864 |
| Molecular Formula | C5H9IN2S3 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine |
| SMILES | CCCSC1=S(I)SC(N)=N1 |
| InChI | InChI=1S/C5H9IN2S3/c1-2-3-9-5-8-4(7)10-11(5)6/h2-3H2,1H3,(H2,7,8) |
| InChIKey | ZOCWZUNJGIOBTA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine?
The IUPAC name of 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine (CID 134989864) is 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine.
What is the SMILES notation for 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine?
The canonical SMILES for 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine is CCCSC1=S(I)SC(N)=N1.
What is the InChIKey of 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine?
The InChIKey is ZOCWZUNJGIOBTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9IN2S3/c1-2-3-9-5-8-4(7)10-11(5)6/h2-3H2,1H3,(H2,7,8).
What are the key properties of 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine?
1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine has a molecular weight of 320.25 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-5-propylsulfanyl-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine is sourced from PubChem (CID 134989864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).