C7H9F6NO — CID 13499029
4-(1,1,2,3,3,3-hexafluoropropyl)morpholine (PubChem CID 13499029) has the molecular formula C7H9F6NO and a molecular weight of 237.14 g/mol. Its IUPAC name is 4-(1,1,2,3,3,3-hexafluoropropyl)morpholine.
| Compound Name | 4-(1,1,2,3,3,3-hexafluoropropyl)morpholine |
|---|---|
| PubChem CID | 13499029 |
| Molecular Formula | C7H9F6NO |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-(1,1,2,3,3,3-hexafluoropropyl)morpholine |
| SMILES | FC(C(F)(F)F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C7H9F6NO/c8-5(6(9,10)11)7(12,13)14-1-3-15-4-2-14/h5H,1-4H2 |
| InChIKey | FOENAJXLMVVYOY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|